![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| screen356.jpg | 2024-06-07 14:58 | 217K | |
| mark_manders_hammer_15d.640x0.jpg | 2024-06-07 14:58 | 216K | |
| VisualHistology_Atlas_2-0-55_1.jpg | 2024-06-07 14:58 | 125K | |
| 1052-5173-19-4i.jpg | 2024-06-07 14:58 | 38K | |
| Pliocene clams.jpg | 2024-06-07 14:58 | 417K | |
| Fatigue_Beachmarks4.JPG | 2024-06-07 14:58 | 49K | |
| F5256fibpap021.jpg | 2024-06-07 14:58 | 95K | |
| Structure and Interpretation of Computer Programs - 2nd Edition.pdf | 2024-06-07 14:58 | 2.1M | |
| mark_manders04.jpg | 2024-06-07 14:58 | 74K | |
| bigtable-osdi06.pdf | 2024-06-07 14:58 | 216K | |